C9H12ClN3O — CID 61247982
N-(3-aminopropyl)-4-chloropyridine-2-carboxamide (PubChem CID 61247982) has the molecular formula C9H12ClN3O and a molecular weight of 213.67 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-chloropyridine-2-carboxamide.
| Compound Name | N-(3-aminopropyl)-4-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 61247982 |
| Molecular Formula | C9H12ClN3O |
| Molecular Weight | 213.67 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | N-(3-aminopropyl)-4-chloropyridine-2-carboxamide |
| SMILES | NCCCNC(=O)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C9H12ClN3O/c10-7-2-5-12-8(6-7)9(14)13-4-1-3-11/h2,5-6H,1,3-4,11H2,(H,13,14) |
| InChIKey | HKRYQRYOEFIRSY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.67 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|