C13H12N2O3S2 — CID 79690462
3-[4-[2-(1,3-thiazol-2-yl)ethylcarbamoyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 79690462) has the molecular formula C13H12N2O3S2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-[4-[2-(1,3-thiazol-2-yl)ethylcarbamoyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | 3-[4-[2-(1,3-thiazol-2-yl)ethylcarbamoyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 79690462 |
| Molecular Formula | C13H12N2O3S2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 3-[4-[2-(1,3-thiazol-2-yl)ethylcarbamoyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cc(C(=O)NCCc2nccs2)cs1 |
| InChI | InChI=1S/C13H12N2O3S2/c16-12(17)2-1-10-7-9(8-20-10)13(18)15-4-3-11-14-5-6-19-11/h1-2,5-8H,3-4H2,(H,15,18)(H,16,17) |
| InChIKey | XRUJVKZXPBWQOA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|