C16H20N2OS — CID 62165167
4-(propylamino)-N-(2-thiophen-2-ylethyl)benzamide (PubChem CID 62165167) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is 4-(propylamino)-N-(2-thiophen-2-ylethyl)benzamide.
| Compound Name | 4-(propylamino)-N-(2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 62165167 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 4-(propylamino)-N-(2-thiophen-2-ylethyl)benzamide |
| SMILES | CCCNc1ccc(C(=O)NCCc2cccs2)cc1 |
| InChI | InChI=1S/C16H20N2OS/c1-2-10-17-14-7-5-13(6-8-14)16(19)18-11-9-15-4-3-12-20-15/h3-8,12,17H,2,9-11H2,1H3,(H,18,19) |
| InChIKey | NDKHMYUPLNVWRX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |