C18H22F3IN4OS — CID 111349841
N-[2-[[N'-methyl-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide (PubChem CID 111349841) has the molecular formula C18H22F3IN4OS and a molecular weight of 526.37 g/mol. Its IUPAC name is N-[2-[[N'-methyl-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide.
| Compound Name | N-[2-[[N'-methyl-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide |
|---|---|
| PubChem CID | 111349841 |
| Molecular Formula | C18H22F3IN4OS |
| Molecular Weight | 526.37 g/mol |
| Exact Mass | 526.05 |
| IUPAC Name | N-[2-[[N'-methyl-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide |
| SMILES | C/N=C(/NCCNC(=O)c1ccc(C(F)(F)F)cc1)NCCc1cccs1.I |
| InChI | InChI=1S/C18H21F3N4OS.HI/c1-22-17(24-9-8-15-3-2-12-27-15)25-11-10-23-16(26)13-4-6-14(7-5-13)18(19,20)21;/h2-7,12H,8-11H2,1H3,(H,23,26)(H2,22,24,25);1H |
| InChIKey | WSKCKTZJALXGGK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|