C20H24F3IN4O — CID 111359697
N-[2-[[N'-methyl-N-[(2-methylphenyl)methyl]carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide (PubChem CID 111359697) has the molecular formula C20H24F3IN4O and a molecular weight of 520.34 g/mol. Its IUPAC name is N-[2-[[N'-methyl-N-[(2-methylphenyl)methyl]carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide.
| Compound Name | N-[2-[[N'-methyl-N-[(2-methylphenyl)methyl]carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide |
|---|---|
| PubChem CID | 111359697 |
| Molecular Formula | C20H24F3IN4O |
| Molecular Weight | 520.34 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | N-[2-[[N'-methyl-N-[(2-methylphenyl)methyl]carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide |
| SMILES | C/N=C(/NCCNC(=O)c1ccc(C(F)(F)F)cc1)NCc1ccccc1C.I |
| InChI | InChI=1S/C20H23F3N4O.HI/c1-14-5-3-4-6-16(14)13-27-19(24-2)26-12-11-25-18(28)15-7-9-17(10-8-15)20(21,22)23;/h3-10H,11-13H2,1-2H3,(H,25,28)(H2,24,26,27);1H |
| InChIKey | ZSXBGVYHRDDCSN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|