C20H23F3IN5O2 — CID 111420190
N-(2-amino-2-oxoethyl)-4-[[[N'-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 111420190) has the molecular formula C20H23F3IN5O2 and a molecular weight of 549.34 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[[N'-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[[N'-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111420190 |
| Molecular Formula | C20H23F3IN5O2 |
| Molecular Weight | 549.34 g/mol |
| Exact Mass | 549.08 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[[N'-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C(=O)NCC(N)=O)cc1)NCc1ccc(C(F)(F)F)cc1.I |
| InChI | InChI=1S/C20H22F3N5O2.HI/c1-25-19(28-11-14-4-8-16(9-5-14)20(21,22)23)27-10-13-2-6-15(7-3-13)18(30)26-12-17(24)29;/h2-9H,10-12H2,1H3,(H2,24,29)(H,26,30)(H2,25,27,28);1H |
| InChIKey | WNPMGPLYNPEBOO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|