C17H27N5O2 — CID 111000287
N-(2-amino-2-oxoethyl)-4-[[[N'-methyl-N-(3-methylbutan-2-yl)carbamimidoyl]amino]methyl]benzamide (PubChem CID 111000287) has the molecular formula C17H27N5O2 and a molecular weight of 333.44 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[[N'-methyl-N-(3-methylbutan-2-yl)carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[[N'-methyl-N-(3-methylbutan-2-yl)carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111000287 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[[N'-methyl-N-(3-methylbutan-2-yl)carbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(/NCc1ccc(C(=O)NCC(N)=O)cc1)NC(C)C(C)C |
| InChI | InChI=1S/C17H27N5O2/c1-11(2)12(3)22-17(19-4)21-9-13-5-7-14(8-6-13)16(24)20-10-15(18)23/h5-8,11-12H,9-10H2,1-4H3,(H2,18,23)(H,20,24)(H2,19,21,22) |
| InChIKey | GMUSTDXKAKBWGL-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|