C17H21F3IN5OS — CID 111522978
N-[2-[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide (PubChem CID 111522978) has the molecular formula C17H21F3IN5OS and a molecular weight of 527.35 g/mol. Its IUPAC name is N-[2-[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide.
| Compound Name | N-[2-[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide |
|---|---|
| PubChem CID | 111522978 |
| Molecular Formula | C17H21F3IN5OS |
| Molecular Weight | 527.35 g/mol |
| Exact Mass | 527.05 |
| IUPAC Name | N-[2-[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]ethyl]-4-(trifluoromethyl)benzamide;hydroiodide |
| SMILES | C/N=C(/NCCNC(=O)c1ccc(C(F)(F)F)cc1)NCc1ncc(C)s1.I |
| InChI | InChI=1S/C17H20F3N5OS.HI/c1-11-9-24-14(27-11)10-25-16(21-2)23-8-7-22-15(26)12-3-5-13(6-4-12)17(18,19)20;/h3-6,9H,7-8,10H2,1-2H3,(H,22,26)(H2,21,23,25);1H |
| InChIKey | QFGFKWKOXWWBFY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|