C15H20FIN4S — CID 111517080
1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111517080) has the molecular formula C15H20FIN4S and a molecular weight of 434.32 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111517080 |
| Molecular Formula | C15H20FIN4S |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccccc1F)NCc1ncc(C)s1.I |
| InChI | InChI=1S/C15H19FN4S.HI/c1-11-9-19-14(21-11)10-20-15(17-2)18-8-7-12-5-3-4-6-13(12)16;/h3-6,9H,7-8,10H2,1-2H3,(H2,17,18,20);1H |
| InChIKey | MKACUBFCVLQJJJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|