C17H22FIN4O2S — CID 111522359
1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111522359) has the molecular formula C17H22FIN4O2S and a molecular weight of 492.36 g/mol. Its IUPAC name is 1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111522359 |
| Molecular Formula | C17H22FIN4O2S |
| Molecular Weight | 492.36 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | 1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1cc(F)cc2c1OCOC2)NCc1ncc(C)s1.I |
| InChI | InChI=1S/C17H21FN4O2S.HI/c1-11-7-21-15(25-11)8-22-17(19-2)20-4-3-12-5-14(18)6-13-9-23-10-24-16(12)13;/h5-7H,3-4,8-10H2,1-2H3,(H2,19,20,22);1H |
| InChIKey | MUQONRKZMHRSBH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|