C20H21F5IN3O2 — CID 111889916
1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111889916) has the molecular formula C20H21F5IN3O2 and a molecular weight of 557.30 g/mol. Its IUPAC name is 1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111889916 |
| Molecular Formula | C20H21F5IN3O2 |
| Molecular Weight | 557.30 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | 1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1cc(F)cc2c1OCOC2)NCc1ccc(F)cc1C(F)(F)F.I |
| InChI | InChI=1S/C20H20F5N3O2.HI/c1-26-19(28-9-13-2-3-15(21)8-17(13)20(23,24)25)27-5-4-12-6-16(22)7-14-10-29-11-30-18(12)14;/h2-3,6-8H,4-5,9-11H2,1H3,(H2,26,27,28);1H |
| InChIKey | BNRYJTTZRUFKMC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.30 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|