C22H27FIN3O3 — CID 111556206
1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-methyl-3-[(2-prop-2-enoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111556206) has the molecular formula C22H27FIN3O3 and a molecular weight of 527.38 g/mol. Its IUPAC name is 1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-methyl-3-[(2-prop-2-enoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-methyl-3-[(2-prop-2-enoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111556206 |
| Molecular Formula | C22H27FIN3O3 |
| Molecular Weight | 527.38 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | 1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-methyl-3-[(2-prop-2-enoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C=CCOc1ccccc1CN/C(=N\C)NCCc1cc(F)cc2c1OCOC2.I |
| InChI | InChI=1S/C22H26FN3O3.HI/c1-3-10-28-20-7-5-4-6-17(20)13-26-22(24-2)25-9-8-16-11-19(23)12-18-14-27-15-29-21(16)18;/h3-7,11-12H,1,8-10,13-15H2,2H3,(H2,24,25,26);1H |
| InChIKey | WWJBFJRDMCXHIP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|