C22H29FIN3O4 — CID 111682159
1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-[2-(2-methoxyphenoxy)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111682159) has the molecular formula C22H29FIN3O4 and a molecular weight of 545.39 g/mol. Its IUPAC name is 1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-[2-(2-methoxyphenoxy)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-[2-(2-methoxyphenoxy)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111682159 |
| Molecular Formula | C22H29FIN3O4 |
| Molecular Weight | 545.39 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | 1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-[2-(2-methoxyphenoxy)propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1cc(F)cc2c1OCOC2)NCC(C)Oc1ccccc1OC.I |
| InChI | InChI=1S/C22H28FN3O4.HI/c1-15(30-20-7-5-4-6-19(20)27-3)12-26-22(24-2)25-9-8-16-10-18(23)11-17-13-28-14-29-21(16)17;/h4-7,10-11,15H,8-9,12-14H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | BVTXEAHNASZSED-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|