C15H22IN5OS2 — CID 111524781
N-[3-[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide (PubChem CID 111524781) has the molecular formula C15H22IN5OS2 and a molecular weight of 479.41 g/mol. Its IUPAC name is N-[3-[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111524781 |
| Molecular Formula | C15H22IN5OS2 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 479.03 |
| IUPAC Name | N-[3-[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)c1cccs1)NCc1ncc(C)s1.I |
| InChI | InChI=1S/C15H21N5OS2.HI/c1-11-9-19-13(23-11)10-20-15(16-2)18-7-4-6-17-14(21)12-5-3-8-22-12;/h3,5,8-9H,4,6-7,10H2,1-2H3,(H,17,21)(H2,16,18,20);1H |
| InChIKey | VCLHMLWRQARGQP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|