C17H22FIN4OS — CID 111876536
N-[3-[[N-[(3-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide (PubChem CID 111876536) has the molecular formula C17H22FIN4OS and a molecular weight of 476.36 g/mol. Its IUPAC name is N-[3-[[N-[(3-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[N-[(3-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111876536 |
| Molecular Formula | C17H22FIN4OS |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | N-[3-[[N-[(3-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)c1cccs1)NCc1cccc(F)c1.I |
| InChI | InChI=1S/C17H21FN4OS.HI/c1-19-17(22-12-13-5-2-6-14(18)11-13)21-9-4-8-20-16(23)15-7-3-10-24-15;/h2-3,5-7,10-11H,4,8-9,12H2,1H3,(H,20,23)(H2,19,21,22);1H |
| InChIKey | TVBPLKQMADDSPT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|