C18H23BrN4OS — CID 111349836
4-bromo-N-[3-[[N'-methyl-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]propyl]benzamide (PubChem CID 111349836) has the molecular formula C18H23BrN4OS and a molecular weight of 423.38 g/mol. Its IUPAC name is 4-bromo-N-[3-[[N'-methyl-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]propyl]benzamide.
| Compound Name | 4-bromo-N-[3-[[N'-methyl-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]propyl]benzamide |
|---|---|
| PubChem CID | 111349836 |
| Molecular Formula | C18H23BrN4OS |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 4-bromo-N-[3-[[N'-methyl-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]propyl]benzamide |
| SMILES | C/N=C(/NCCCNC(=O)c1ccc(Br)cc1)NCCc1cccs1 |
| InChI | InChI=1S/C18H23BrN4OS/c1-20-18(23-12-9-16-4-2-13-25-16)22-11-3-10-21-17(24)14-5-7-15(19)8-6-14/h2,4-8,13H,3,9-12H2,1H3,(H,21,24)(H2,20,22,23) |
| InChIKey | VLLFHLOSFDKBBX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|