C12H17BrN4O — CID 110917998
4-bromo-N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]benzamide (PubChem CID 110917998) has the molecular formula C12H17BrN4O and a molecular weight of 313.20 g/mol. Its IUPAC name is 4-bromo-N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]benzamide.
| Compound Name | 4-bromo-N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 110917998 |
| Molecular Formula | C12H17BrN4O |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 4-bromo-N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]benzamide |
| SMILES | C/N=C(\NC)NCCNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H17BrN4O/c1-14-12(15-2)17-8-7-16-11(18)9-3-5-10(13)6-4-9/h3-6H,7-8H2,1-2H3,(H,16,18)(H2,14,15,17) |
| InChIKey | OKXXHJYXRCWNPQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|