C15H23BrN4O — CID 111225655
4-bromo-N-[2-[(N-ethyl-N'-propylcarbamimidoyl)amino]ethyl]benzamide (PubChem CID 111225655) has the molecular formula C15H23BrN4O and a molecular weight of 355.28 g/mol. Its IUPAC name is 4-bromo-N-[2-[(N-ethyl-N'-propylcarbamimidoyl)amino]ethyl]benzamide.
| Compound Name | 4-bromo-N-[2-[(N-ethyl-N'-propylcarbamimidoyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111225655 |
| Molecular Formula | C15H23BrN4O |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 4-bromo-N-[2-[(N-ethyl-N'-propylcarbamimidoyl)amino]ethyl]benzamide |
| SMILES | CCC/N=C(\NCC)NCCNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H23BrN4O/c1-3-9-19-15(17-4-2)20-11-10-18-14(21)12-5-7-13(16)8-6-12/h5-8H,3-4,9-11H2,1-2H3,(H,18,21)(H2,17,19,20) |
| InChIKey | JGDXNKWYZPCICB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|