C17H26BrIN4O — CID 111868815
4-bromo-N-[3-[[N'-(cyclopropylmethyl)-N-ethylcarbamimidoyl]amino]propyl]benzamide;hydroiodide (PubChem CID 111868815) has the molecular formula C17H26BrIN4O and a molecular weight of 509.23 g/mol. Its IUPAC name is 4-bromo-N-[3-[[N'-(cyclopropylmethyl)-N-ethylcarbamimidoyl]amino]propyl]benzamide;hydroiodide.
| Compound Name | 4-bromo-N-[3-[[N'-(cyclopropylmethyl)-N-ethylcarbamimidoyl]amino]propyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111868815 |
| Molecular Formula | C17H26BrIN4O |
| Molecular Weight | 509.23 g/mol |
| Exact Mass | 508.03 |
| IUPAC Name | 4-bromo-N-[3-[[N'-(cyclopropylmethyl)-N-ethylcarbamimidoyl]amino]propyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CC1)NCCCNC(=O)c1ccc(Br)cc1.I |
| InChI | InChI=1S/C17H25BrN4O.HI/c1-2-19-17(22-12-13-4-5-13)21-11-3-10-20-16(23)14-6-8-15(18)9-7-14;/h6-9,13H,2-5,10-12H2,1H3,(H,20,23)(H2,19,21,22);1H |
| InChIKey | WVRBOBLJVIXSJM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.23 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|