C14H23IN4O2 — CID 111867575
N-[2-[[N'-(cyclopropylmethyl)-N-ethylcarbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide (PubChem CID 111867575) has the molecular formula C14H23IN4O2 and a molecular weight of 406.27 g/mol. Its IUPAC name is N-[2-[[N'-(cyclopropylmethyl)-N-ethylcarbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N'-(cyclopropylmethyl)-N-ethylcarbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111867575 |
| Molecular Formula | C14H23IN4O2 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | N-[2-[[N'-(cyclopropylmethyl)-N-ethylcarbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CC1)NCCNC(=O)c1ccco1.I |
| InChI | InChI=1S/C14H22N4O2.HI/c1-2-15-14(18-10-11-5-6-11)17-8-7-16-13(19)12-4-3-9-20-12;/h3-4,9,11H,2,5-8,10H2,1H3,(H,16,19)(H2,15,17,18);1H |
| InChIKey | VSIGBRZZEQVAMH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|