C16H21BrN4O — CID 136922199
4-bromo-N-[3-[[ethylamino-(prop-2-ynylamino)methylidene]amino]propyl]benzamide (PubChem CID 136922199) has the molecular formula C16H21BrN4O and a molecular weight of 365.28 g/mol. Its IUPAC name is 4-bromo-N-[3-[[ethylamino-(prop-2-ynylamino)methylidene]amino]propyl]benzamide.
| Compound Name | 4-bromo-N-[3-[[ethylamino-(prop-2-ynylamino)methylidene]amino]propyl]benzamide |
|---|---|
| PubChem CID | 136922199 |
| Molecular Formula | C16H21BrN4O |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 4-bromo-N-[3-[[ethylamino-(prop-2-ynylamino)methylidene]amino]propyl]benzamide |
| SMILES | C#CCN/C(=N/CCCNC(=O)c1ccc(Br)cc1)NCC |
| InChI | InChI=1S/C16H21BrN4O/c1-3-10-20-16(18-4-2)21-12-5-11-19-15(22)13-6-8-14(17)9-7-13/h1,6-9H,4-5,10-12H2,2H3,(H,19,22)(H2,18,20,21) |
| InChIKey | MDHVCBWFMLWDMF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|