C18H27BrIN5O2 — CID 111926907
4-bromo-N-[2-[[N'-[2-(cyclopropanecarbonylamino)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111926907) has the molecular formula C18H27BrIN5O2 and a molecular weight of 552.26 g/mol. Its IUPAC name is 4-bromo-N-[2-[[N'-[2-(cyclopropanecarbonylamino)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | 4-bromo-N-[2-[[N'-[2-(cyclopropanecarbonylamino)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111926907 |
| Molecular Formula | C18H27BrIN5O2 |
| Molecular Weight | 552.26 g/mol |
| Exact Mass | 551.04 |
| IUPAC Name | 4-bromo-N-[2-[[N'-[2-(cyclopropanecarbonylamino)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)C1CC1)NCCNC(=O)c1ccc(Br)cc1.I |
| InChI | InChI=1S/C18H26BrN5O2.HI/c1-2-20-18(23-11-9-21-16(25)13-3-4-13)24-12-10-22-17(26)14-5-7-15(19)8-6-14;/h5-8,13H,2-4,9-12H2,1H3,(H,21,25)(H,22,26)(H2,20,23,24);1H |
| InChIKey | SSPHTGSYEWFNBB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 94.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|