C18H26BrN5O2 — CID 111928144
N-[2-[[N'-[2-(5-bromo-2-methylanilino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide (PubChem CID 111928144) has the molecular formula C18H26BrN5O2 and a molecular weight of 424.34 g/mol. Its IUPAC name is N-[2-[[N'-[2-(5-bromo-2-methylanilino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[N'-[2-(5-bromo-2-methylanilino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 111928144 |
| Molecular Formula | C18H26BrN5O2 |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | N-[2-[[N'-[2-(5-bromo-2-methylanilino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
| SMILES | CCN/C(=N\CC(=O)Nc1cc(Br)ccc1C)NCCNC(=O)C1CC1 |
| InChI | InChI=1S/C18H26BrN5O2/c1-3-20-18(22-9-8-21-17(26)13-5-6-13)23-11-16(25)24-15-10-14(19)7-4-12(15)2/h4,7,10,13H,3,5-6,8-9,11H2,1-2H3,(H,21,26)(H,24,25)(H2,20,22,23) |
| InChIKey | KHXSNRUJOMYJGK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 94.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|