C20H33BrIN5O — CID 111261722
N-(5-bromo-2-methylphenyl)-3-[[N-ethyl-N'-[(1-ethylpyrrolidin-2-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111261722) has the molecular formula C20H33BrIN5O and a molecular weight of 566.33 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-3-[[N-ethyl-N'-[(1-ethylpyrrolidin-2-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-(5-bromo-2-methylphenyl)-3-[[N-ethyl-N'-[(1-ethylpyrrolidin-2-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111261722 |
| Molecular Formula | C20H33BrIN5O |
| Molecular Weight | 566.33 g/mol |
| Exact Mass | 565.09 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-3-[[N-ethyl-N'-[(1-ethylpyrrolidin-2-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CCCN1CC)NCCC(=O)Nc1cc(Br)ccc1C.I |
| InChI | InChI=1S/C20H32BrN5O.HI/c1-4-22-20(24-14-17-7-6-12-26(17)5-2)23-11-10-19(27)25-18-13-16(21)9-8-15(18)3;/h8-9,13,17H,4-7,10-12,14H2,1-3H3,(H,25,27)(H2,22,23,24);1H |
| InChIKey | WSTDQTZVEXNGEY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|