C14H22BrIN4O — CID 110926492
2-[bis(ethylamino)methylideneamino]-N-(5-bromo-2-methylphenyl)acetamide;hydroiodide (PubChem CID 110926492) has the molecular formula C14H22BrIN4O and a molecular weight of 469.17 g/mol. Its IUPAC name is 2-[bis(ethylamino)methylideneamino]-N-(5-bromo-2-methylphenyl)acetamide;hydroiodide.
| Compound Name | 2-[bis(ethylamino)methylideneamino]-N-(5-bromo-2-methylphenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 110926492 |
| Molecular Formula | C14H22BrIN4O |
| Molecular Weight | 469.17 g/mol |
| Exact Mass | 468.00 |
| IUPAC Name | 2-[bis(ethylamino)methylideneamino]-N-(5-bromo-2-methylphenyl)acetamide;hydroiodide |
| SMILES | CCNC(=NCC(=O)Nc1cc(Br)ccc1C)NCC.I |
| InChI | InChI=1S/C14H21BrN4O.HI/c1-4-16-14(17-5-2)18-9-13(20)19-12-8-11(15)7-6-10(12)3;/h6-8H,4-5,9H2,1-3H3,(H,19,20)(H2,16,17,18);1H |
| InChIKey | VEHPLTOHFDJPJT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.17 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|