C19H26BrN5O2 — CID 109432003
N-(5-bromo-2-methylphenyl)-3-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]propanamide (PubChem CID 109432003) has the molecular formula C19H26BrN5O2 and a molecular weight of 436.35 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-3-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]propanamide.
| Compound Name | N-(5-bromo-2-methylphenyl)-3-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 109432003 |
| Molecular Formula | C19H26BrN5O2 |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-3-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]propanamide |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)NCCC(=O)Nc1cc(Br)ccc1C |
| InChI | InChI=1S/C19H26BrN5O2/c1-5-21-19(23-11-18-24-13(3)14(4)27-18)22-9-8-17(26)25-16-10-15(20)7-6-12(16)2/h6-7,10H,5,8-9,11H2,1-4H3,(H,25,26)(H2,21,22,23) |
| InChIKey | PMFROENLJPOYOS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|