C21H25BrN4O2 — CID 109429425
1-[2-(6-bromonaphthalen-2-yl)oxyethyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine (PubChem CID 109429425) has the molecular formula C21H25BrN4O2 and a molecular weight of 445.36 g/mol. Its IUPAC name is 1-[2-(6-bromonaphthalen-2-yl)oxyethyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine.
| Compound Name | 1-[2-(6-bromonaphthalen-2-yl)oxyethyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 109429425 |
| Molecular Formula | C21H25BrN4O2 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 1-[2-(6-bromonaphthalen-2-yl)oxyethyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)NCCOc1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C21H25BrN4O2/c1-4-23-21(25-13-20-26-14(2)15(3)28-20)24-9-10-27-19-8-6-16-11-18(22)7-5-17(16)12-19/h5-8,11-12H,4,9-10,13H2,1-3H3,(H2,23,24,25) |
| InChIKey | GUQMGKRURWCUKF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|