C17H23FN4O2 — CID 109429901
2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(3-fluorophenoxy)ethyl]guanidine (PubChem CID 109429901) has the molecular formula C17H23FN4O2 and a molecular weight of 334.39 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(3-fluorophenoxy)ethyl]guanidine.
| Compound Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(3-fluorophenoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 109429901 |
| Molecular Formula | C17H23FN4O2 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(3-fluorophenoxy)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)NCCOc1cccc(F)c1 |
| InChI | InChI=1S/C17H23FN4O2/c1-4-19-17(21-11-16-22-12(2)13(3)24-16)20-8-9-23-15-7-5-6-14(18)10-15/h5-7,10H,4,8-9,11H2,1-3H3,(H2,19,20,21) |
| InChIKey | YVZLXRKUSPUIAA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|