C14H26IN5O2 — CID 109428698
3-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide (PubChem CID 109428698) has the molecular formula C14H26IN5O2 and a molecular weight of 423.30 g/mol. Its IUPAC name is 3-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 109428698 |
| Molecular Formula | C14H26IN5O2 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 3-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)NCCC(=O)N(C)C.I |
| InChI | InChI=1S/C14H25N5O2.HI/c1-6-15-14(16-8-7-13(20)19(4)5)17-9-12-18-10(2)11(3)21-12;/h6-9H2,1-5H3,(H2,15,16,17);1H |
| InChIKey | ZIEFAJSRVDZKDX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|