C14H25N5O2 — CID 109429881
3-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]-2,2-dimethylpropanamide (PubChem CID 109429881) has the molecular formula C14H25N5O2 and a molecular weight of 295.39 g/mol. Its IUPAC name is 3-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 109429881 |
| Molecular Formula | C14H25N5O2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 3-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]-2,2-dimethylpropanamide |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)NCC(C)(C)C(N)=O |
| InChI | InChI=1S/C14H25N5O2/c1-6-16-13(18-8-14(4,5)12(15)20)17-7-11-19-9(2)10(3)21-11/h6-8H2,1-5H3,(H2,15,20)(H2,16,17,18) |
| InChIKey | JEDKSODXHJZSHX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|