C19H27Cl2IN4O — CID 109432436
1-[2-(3,4-dichlorophenyl)-2-methylpropyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 109432436) has the molecular formula C19H27Cl2IN4O and a molecular weight of 525.26 g/mol. Its IUPAC name is 1-[2-(3,4-dichlorophenyl)-2-methylpropyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dichlorophenyl)-2-methylpropyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109432436 |
| Molecular Formula | C19H27Cl2IN4O |
| Molecular Weight | 525.26 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | 1-[2-(3,4-dichlorophenyl)-2-methylpropyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)NCC(C)(C)c1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C19H26Cl2N4O.HI/c1-6-22-18(23-10-17-25-12(2)13(3)26-17)24-11-19(4,5)14-7-8-15(20)16(21)9-14;/h7-9H,6,10-11H2,1-5H3,(H2,22,23,24);1H |
| InChIKey | ODNLRRXXHKQOJD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.26 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|