C17H23ClN4O2 — CID 109431547
1-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine (PubChem CID 109431547) has the molecular formula C17H23ClN4O2 and a molecular weight of 350.85 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine.
| Compound Name | 1-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 109431547 |
| Molecular Formula | C17H23ClN4O2 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)NCC(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H23ClN4O2/c1-4-19-17(21-10-16-22-11(2)12(3)24-16)20-9-15(23)13-5-7-14(18)8-6-13/h5-8,15,23H,4,9-10H2,1-3H3,(H2,19,20,21) |
| InChIKey | RZIUTZIFORKYDX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|