C17H27BrN4O — CID 111152026
N-(4-bromo-2-methylphenyl)-3-[(N'-butyl-N-ethylcarbamimidoyl)amino]propanamide (PubChem CID 111152026) has the molecular formula C17H27BrN4O and a molecular weight of 383.33 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-3-[(N'-butyl-N-ethylcarbamimidoyl)amino]propanamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-3-[(N'-butyl-N-ethylcarbamimidoyl)amino]propanamide |
|---|---|
| PubChem CID | 111152026 |
| Molecular Formula | C17H27BrN4O |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-3-[(N'-butyl-N-ethylcarbamimidoyl)amino]propanamide |
| SMILES | CCCC/N=C(\NCC)NCCC(=O)Nc1ccc(Br)cc1C |
| InChI | InChI=1S/C17H27BrN4O/c1-4-6-10-20-17(19-5-2)21-11-9-16(23)22-15-8-7-14(18)12-13(15)3/h7-8,12H,4-6,9-11H2,1-3H3,(H,22,23)(H2,19,20,21) |
| InChIKey | ZPTZMDIJDOUWTM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|