C17H24BrN7O — CID 111708371
N-(5-bromo-2-methylphenyl)-3-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]propanamide (PubChem CID 111708371) has the molecular formula C17H24BrN7O and a molecular weight of 422.33 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-3-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]propanamide.
| Compound Name | N-(5-bromo-2-methylphenyl)-3-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111708371 |
| Molecular Formula | C17H24BrN7O |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-3-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]propanamide |
| SMILES | CCN/C(=N\Cc1ncnn1C)NCCC(=O)Nc1cc(Br)ccc1C |
| InChI | InChI=1S/C17H24BrN7O/c1-4-19-17(21-10-15-22-11-23-25(15)3)20-8-7-16(26)24-14-9-13(18)6-5-12(14)2/h5-6,9,11H,4,7-8,10H2,1-3H3,(H,24,26)(H2,19,20,21) |
| InChIKey | BLDPUEMPPGDCDP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|