C17H23BrN6O — CID 111956441
N-(5-bromo-2-methylphenyl)-3-[[N'-methyl-N-[(2-methylpyrazol-3-yl)methyl]carbamimidoyl]amino]propanamide (PubChem CID 111956441) has the molecular formula C17H23BrN6O and a molecular weight of 407.32 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-3-[[N'-methyl-N-[(2-methylpyrazol-3-yl)methyl]carbamimidoyl]amino]propanamide.
| Compound Name | N-(5-bromo-2-methylphenyl)-3-[[N'-methyl-N-[(2-methylpyrazol-3-yl)methyl]carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111956441 |
| Molecular Formula | C17H23BrN6O |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-3-[[N'-methyl-N-[(2-methylpyrazol-3-yl)methyl]carbamimidoyl]amino]propanamide |
| SMILES | C/N=C(/NCCC(=O)Nc1cc(Br)ccc1C)NCc1ccnn1C |
| InChI | InChI=1S/C17H23BrN6O/c1-12-4-5-13(18)10-15(12)23-16(25)7-8-20-17(19-2)21-11-14-6-9-22-24(14)3/h4-6,9-10H,7-8,11H2,1-3H3,(H,23,25)(H2,19,20,21) |
| InChIKey | YSIAGFXMSHCSFM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|