C10H19N5 — CID 111226466
2-methyl-1-[(2-methylpyrazol-3-yl)methyl]-3-propylguanidine (PubChem CID 111226466) has the molecular formula C10H19N5 and a molecular weight of 209.30 g/mol. Its IUPAC name is 2-methyl-1-[(2-methylpyrazol-3-yl)methyl]-3-propylguanidine.
| Compound Name | 2-methyl-1-[(2-methylpyrazol-3-yl)methyl]-3-propylguanidine |
|---|---|
| PubChem CID | 111226466 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 2-methyl-1-[(2-methylpyrazol-3-yl)methyl]-3-propylguanidine |
| SMILES | CCCN/C(=N\C)NCc1ccnn1C |
| InChI | InChI=1S/C10H19N5/c1-4-6-12-10(11-2)13-8-9-5-7-14-15(9)3/h5,7H,4,6,8H2,1-3H3,(H2,11,12,13) |
| InChIKey | GZSRAGMHUSXKJS-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|