C13H22IN7 — CID 111953898
1-(3-imidazol-1-ylpropyl)-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111953898) has the molecular formula C13H22IN7 and a molecular weight of 403.27 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111953898 |
| Molecular Formula | C13H22IN7 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCn1ccnc1)NCc1ccnn1C.I |
| InChI | InChI=1S/C13H21N7.HI/c1-14-13(17-10-12-4-6-18-19(12)2)16-5-3-8-20-9-7-15-11-20;/h4,6-7,9,11H,3,5,8,10H2,1-2H3,(H2,14,16,17);1H |
| InChIKey | BWDUKLNRGMFGIW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|