C19H23BrN4O — CID 110953780
3-[(N-benzyl-N'-methylcarbamimidoyl)amino]-N-(5-bromo-2-methylphenyl)propanamide (PubChem CID 110953780) has the molecular formula C19H23BrN4O and a molecular weight of 403.32 g/mol. Its IUPAC name is 3-[(N-benzyl-N'-methylcarbamimidoyl)amino]-N-(5-bromo-2-methylphenyl)propanamide.
| Compound Name | 3-[(N-benzyl-N'-methylcarbamimidoyl)amino]-N-(5-bromo-2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 110953780 |
| Molecular Formula | C19H23BrN4O |
| Molecular Weight | 403.32 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 3-[(N-benzyl-N'-methylcarbamimidoyl)amino]-N-(5-bromo-2-methylphenyl)propanamide |
| SMILES | C/N=C(/NCCC(=O)Nc1cc(Br)ccc1C)NCc1ccccc1 |
| InChI | InChI=1S/C19H23BrN4O/c1-14-8-9-16(20)12-17(14)24-18(25)10-11-22-19(21-2)23-13-15-6-4-3-5-7-15/h3-9,12H,10-11,13H2,1-2H3,(H,24,25)(H2,21,22,23) |
| InChIKey | LFXJKEVBUDOCAD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|