C16H26BrIN4O — CID 110944549
N-(5-bromo-2-methylphenyl)-2-[[(butan-2-ylamino)-(ethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110944549) has the molecular formula C16H26BrIN4O and a molecular weight of 497.22 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-2-[[(butan-2-ylamino)-(ethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-(5-bromo-2-methylphenyl)-2-[[(butan-2-ylamino)-(ethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110944549 |
| Molecular Formula | C16H26BrIN4O |
| Molecular Weight | 497.22 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-2-[[(butan-2-ylamino)-(ethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1cc(Br)ccc1C)NC(C)CC.I |
| InChI | InChI=1S/C16H25BrN4O.HI/c1-5-12(4)20-16(18-6-2)19-10-15(22)21-14-9-13(17)8-7-11(14)3;/h7-9,12H,5-6,10H2,1-4H3,(H,21,22)(H2,18,19,20);1H |
| InChIKey | TUJZOWGLNMLUKT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.22 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|