C19H32BrIN4O2 — CID 111713186
N-(5-bromo-2-methylphenyl)-2-[[ethylamino-[2-(2-hydroxyethyl)pentylamino]methylidene]amino]acetamide;hydroiodide (PubChem CID 111713186) has the molecular formula C19H32BrIN4O2 and a molecular weight of 555.30 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-2-[[ethylamino-[2-(2-hydroxyethyl)pentylamino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-(5-bromo-2-methylphenyl)-2-[[ethylamino-[2-(2-hydroxyethyl)pentylamino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111713186 |
| Molecular Formula | C19H32BrIN4O2 |
| Molecular Weight | 555.30 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-2-[[ethylamino-[2-(2-hydroxyethyl)pentylamino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CCCC(CCO)CN/C(=N/CC(=O)Nc1cc(Br)ccc1C)NCC.I |
| InChI | InChI=1S/C19H31BrN4O2.HI/c1-4-6-15(9-10-25)12-22-19(21-5-2)23-13-18(26)24-17-11-16(20)8-7-14(17)3;/h7-8,11,15,25H,4-6,9-10,12-13H2,1-3H3,(H,24,26)(H2,21,22,23);1H |
| InChIKey | FWPSXROOGOHGGV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|