C16H35IN4O2 — CID 111711984
N-tert-butyl-2-[[ethylamino-[2-(2-hydroxyethyl)pentylamino]methylidene]amino]acetamide;hydroiodide (PubChem CID 111711984) has the molecular formula C16H35IN4O2 and a molecular weight of 442.39 g/mol. Its IUPAC name is N-tert-butyl-2-[[ethylamino-[2-(2-hydroxyethyl)pentylamino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[ethylamino-[2-(2-hydroxyethyl)pentylamino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111711984 |
| Molecular Formula | C16H35IN4O2 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | N-tert-butyl-2-[[ethylamino-[2-(2-hydroxyethyl)pentylamino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CCCC(CCO)CN/C(=N/CC(=O)NC(C)(C)C)NCC.I |
| InChI | InChI=1S/C16H34N4O2.HI/c1-6-8-13(9-10-21)11-18-15(17-7-2)19-12-14(22)20-16(3,4)5;/h13,21H,6-12H2,1-5H3,(H,20,22)(H2,17,18,19);1H |
| InChIKey | AWDQRSICZXBEGQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|