C17H28BrIN4OS — CID 111611749
N-(5-bromo-2-methylphenyl)-2-[[ethylamino-[(2-methyl-2-methylsulfanylpropyl)amino]methylidene]amino]acetamide;hydroiodide (PubChem CID 111611749) has the molecular formula C17H28BrIN4OS and a molecular weight of 543.31 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-2-[[ethylamino-[(2-methyl-2-methylsulfanylpropyl)amino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-(5-bromo-2-methylphenyl)-2-[[ethylamino-[(2-methyl-2-methylsulfanylpropyl)amino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111611749 |
| Molecular Formula | C17H28BrIN4OS |
| Molecular Weight | 543.31 g/mol |
| Exact Mass | 542.02 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-2-[[ethylamino-[(2-methyl-2-methylsulfanylpropyl)amino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1cc(Br)ccc1C)NCC(C)(C)SC.I |
| InChI | InChI=1S/C17H27BrN4OS.HI/c1-6-19-16(21-11-17(3,4)24-5)20-10-15(23)22-14-9-13(18)8-7-12(14)2;/h7-9H,6,10-11H2,1-5H3,(H,22,23)(H2,19,20,21);1H |
| InChIKey | NMKNNOLDOBVBCF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|