C20H34BrIN4O2 — CID 111716675
N-(5-bromo-2-methylphenyl)-2-[[[(2,2-diethyl-4-hydroxybutyl)amino]-(ethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 111716675) has the molecular formula C20H34BrIN4O2 and a molecular weight of 569.33 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-2-[[[(2,2-diethyl-4-hydroxybutyl)amino]-(ethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-(5-bromo-2-methylphenyl)-2-[[[(2,2-diethyl-4-hydroxybutyl)amino]-(ethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111716675 |
| Molecular Formula | C20H34BrIN4O2 |
| Molecular Weight | 569.33 g/mol |
| Exact Mass | 568.09 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-2-[[[(2,2-diethyl-4-hydroxybutyl)amino]-(ethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1cc(Br)ccc1C)NCC(CC)(CC)CCO.I |
| InChI | InChI=1S/C20H33BrN4O2.HI/c1-5-20(6-2,10-11-26)14-24-19(22-7-3)23-13-18(27)25-17-12-16(21)9-8-15(17)4;/h8-9,12,26H,5-7,10-11,13-14H2,1-4H3,(H,25,27)(H2,22,23,24);1H |
| InChIKey | PZMRDAALCSHNRX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|