C20H32ClN5O — CID 111262645
N-(3-chloro-2-methylphenyl)-3-[[N-ethyl-N'-[(1-ethylpyrrolidin-2-yl)methyl]carbamimidoyl]amino]propanamide (PubChem CID 111262645) has the molecular formula C20H32ClN5O and a molecular weight of 393.96 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-3-[[N-ethyl-N'-[(1-ethylpyrrolidin-2-yl)methyl]carbamimidoyl]amino]propanamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-3-[[N-ethyl-N'-[(1-ethylpyrrolidin-2-yl)methyl]carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111262645 |
| Molecular Formula | C20H32ClN5O |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-3-[[N-ethyl-N'-[(1-ethylpyrrolidin-2-yl)methyl]carbamimidoyl]amino]propanamide |
| SMILES | CCN/C(=N\CC1CCCN1CC)NCCC(=O)Nc1cccc(Cl)c1C |
| InChI | InChI=1S/C20H32ClN5O/c1-4-22-20(24-14-16-8-7-13-26(16)5-2)23-12-11-19(27)25-18-10-6-9-17(21)15(18)3/h6,9-10,16H,4-5,7-8,11-14H2,1-3H3,(H,25,27)(H2,22,23,24) |
| InChIKey | DAKAGJWODVZYCE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|