C19H26ClN5OS — CID 111535072
N-(3-chloro-2-methylphenyl)-3-[[N-ethyl-N'-[(5-ethyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]propanamide (PubChem CID 111535072) has the molecular formula C19H26ClN5OS and a molecular weight of 407.97 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-3-[[N-ethyl-N'-[(5-ethyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]propanamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-3-[[N-ethyl-N'-[(5-ethyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111535072 |
| Molecular Formula | C19H26ClN5OS |
| Molecular Weight | 407.97 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-3-[[N-ethyl-N'-[(5-ethyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]propanamide |
| SMILES | CCN/C(=N\Cc1ncc(CC)s1)NCCC(=O)Nc1cccc(Cl)c1C |
| InChI | InChI=1S/C19H26ClN5OS/c1-4-14-11-23-18(27-14)12-24-19(21-5-2)22-10-9-17(26)25-16-8-6-7-15(20)13(16)3/h6-8,11H,4-5,9-10,12H2,1-3H3,(H,25,26)(H2,21,22,24) |
| InChIKey | AOQNYVNSJCQXDC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.97 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|