C20H25ClIN7O — CID 111014796
N-(3-chloro-2-methylphenyl)-3-[[N-ethyl-N'-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111014796) has the molecular formula C20H25ClIN7O and a molecular weight of 541.83 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-3-[[N-ethyl-N'-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-(3-chloro-2-methylphenyl)-3-[[N-ethyl-N'-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111014796 |
| Molecular Formula | C20H25ClIN7O |
| Molecular Weight | 541.83 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-3-[[N-ethyl-N'-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCCC(=O)Nc1cccc(Cl)c1C.I |
| InChI | InChI=1S/C20H24ClN7O.HI/c1-3-22-20(24-13-18-27-26-17-9-4-5-12-28(17)18)23-11-10-19(29)25-16-8-6-7-15(21)14(16)2;/h4-9,12H,3,10-11,13H2,1-2H3,(H,25,29)(H2,22,23,24);1H |
| InChIKey | CUNFASJBSRIWQX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.83 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|