C18H22IN7O — CID 111014578
2-[[N-ethyl-N'-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)carbamimidoyl]amino]-N-phenylacetamide;hydroiodide (PubChem CID 111014578) has the molecular formula C18H22IN7O and a molecular weight of 479.33 g/mol. Its IUPAC name is 2-[[N-ethyl-N'-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)carbamimidoyl]amino]-N-phenylacetamide;hydroiodide.
| Compound Name | 2-[[N-ethyl-N'-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)carbamimidoyl]amino]-N-phenylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111014578 |
| Molecular Formula | C18H22IN7O |
| Molecular Weight | 479.33 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | 2-[[N-ethyl-N'-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)carbamimidoyl]amino]-N-phenylacetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCC(=O)Nc1ccccc1.I |
| InChI | InChI=1S/C18H21N7O.HI/c1-2-19-18(21-13-17(26)22-14-8-4-3-5-9-14)20-12-16-24-23-15-10-6-7-11-25(15)16;/h3-11H,2,12-13H2,1H3,(H,22,26)(H2,19,20,21);1H |
| InChIKey | RZYIDTHOOVHVGU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|