C20H27IN6 — CID 111014498
1-ethyl-3-(2-methyl-2-phenylpropyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111014498) has the molecular formula C20H27IN6 and a molecular weight of 478.38 g/mol. Its IUPAC name is 1-ethyl-3-(2-methyl-2-phenylpropyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-methyl-2-phenylpropyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111014498 |
| Molecular Formula | C20H27IN6 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 1-ethyl-3-(2-methyl-2-phenylpropyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCC(C)(C)c1ccccc1.I |
| InChI | InChI=1S/C20H26N6.HI/c1-4-21-19(23-15-20(2,3)16-10-6-5-7-11-16)22-14-18-25-24-17-12-8-9-13-26(17)18;/h5-13H,4,14-15H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | ZADLMTSHDTYICT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|