C22H31IN6 — CID 111499924
1-ethyl-3-(2-ethyl-2-phenylbutyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111499924) has the molecular formula C22H31IN6 and a molecular weight of 506.44 g/mol. Its IUPAC name is 1-ethyl-3-(2-ethyl-2-phenylbutyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-ethyl-2-phenylbutyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111499924 |
| Molecular Formula | C22H31IN6 |
| Molecular Weight | 506.44 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 1-ethyl-3-(2-ethyl-2-phenylbutyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCC(CC)(CC)c1ccccc1.I |
| InChI | InChI=1S/C22H30N6.HI/c1-4-22(5-2,18-12-8-7-9-13-18)17-25-21(23-6-3)24-16-20-27-26-19-14-10-11-15-28(19)20;/h7-15H,4-6,16-17H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | QPBTWWBLUGHRLU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|