C21H30ClIN4O3 — CID 111664528
N-(3-chloro-2-methylphenyl)-3-[[N-ethyl-N'-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111664528) has the molecular formula C21H30ClIN4O3 and a molecular weight of 548.85 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-3-[[N-ethyl-N'-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-(3-chloro-2-methylphenyl)-3-[[N-ethyl-N'-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111664528 |
| Molecular Formula | C21H30ClIN4O3 |
| Molecular Weight | 548.85 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-3-[[N-ethyl-N'-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccc(C)o1)NCCC(=O)Nc1cccc(Cl)c1C.I |
| InChI | InChI=1S/C21H29ClN4O3.HI/c1-5-23-20(25-13-21(4,28)18-10-9-14(2)29-18)24-12-11-19(27)26-17-8-6-7-16(22)15(17)3;/h6-10,28H,5,11-13H2,1-4H3,(H,26,27)(H2,23,24,25);1H |
| InChIKey | IGLOARNDXWIWGP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 98.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.85 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|